C12H21N3O2 — CID 120586281
3-[(3-tert-butyl-1H-pyrazol-5-yl)methyl-methylamino]propanoic acid (PubChem CID 120586281) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1H-pyrazol-5-yl)methyl-methylamino]propanoic acid.
| Compound Name | 3-[(3-tert-butyl-1H-pyrazol-5-yl)methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 120586281 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-[(3-tert-butyl-1H-pyrazol-5-yl)methyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)Cc1cc(C(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C12H21N3O2/c1-12(2,3)10-7-9(13-14-10)8-15(4)6-5-11(16)17/h7H,5-6,8H2,1-4H3,(H,13,14)(H,16,17) |
| InChIKey | FQOFNQBKXCHAJP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |