C17H27N5O — CID 122563299
1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-(3-pyrrol-1-ylpropyl)urea (PubChem CID 122563299) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-(3-pyrrol-1-ylpropyl)urea.
| Compound Name | 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-(3-pyrrol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 122563299 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-(3-pyrrol-1-ylpropyl)urea |
| SMILES | CN(Cc1cc(C(C)(C)C)n[nH]1)C(=O)NCCCn1cccc1 |
| InChI | InChI=1S/C17H27N5O/c1-17(2,3)15-12-14(19-20-15)13-21(4)16(23)18-8-7-11-22-9-5-6-10-22/h5-6,9-10,12H,7-8,11,13H2,1-4H3,(H,18,23)(H,19,20) |
| InChIKey | BFUGYNNDSVPZSN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|