C18H24N8O — CID 118772140
1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-[4-(5-methyltetrazol-1-yl)phenyl]urea (PubChem CID 118772140) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-[4-(5-methyltetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-[4-(5-methyltetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 118772140 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(3-tert-butyl-1H-pyrazol-5-yl)methyl]-1-methyl-3-[4-(5-methyltetrazol-1-yl)phenyl]urea |
| SMILES | Cc1nnnn1-c1ccc(NC(=O)N(C)Cc2cc(C(C)(C)C)n[nH]2)cc1 |
| InChI | InChI=1S/C18H24N8O/c1-12-20-23-24-26(12)15-8-6-13(7-9-15)19-17(27)25(5)11-14-10-16(22-21-14)18(2,3)4/h6-10H,11H2,1-5H3,(H,19,27)(H,21,22) |
| InChIKey | ZSNPIUTWILHXSK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |