C16H29NO — CID 5095009
3-(2-ethylhexylamino)-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 5095009) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 3-(2-ethylhexylamino)-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-(2-ethylhexylamino)-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 5095009 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 3-(2-ethylhexylamino)-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CCCCC(CC)CNC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C16H29NO/c1-5-7-8-13(6-2)12-17-14-9-15(18)11-16(3,4)10-14/h9,13,17H,5-8,10-12H2,1-4H3 |
| InChIKey | DWNAGDXZNFESNB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |