C15H22N6OS — CID 50953093
1-[2-[2-(1-methylimidazol-2-yl)sulfanylethylamino]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 50953093) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-[2-[2-(1-methylimidazol-2-yl)sulfanylethylamino]pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[2-[2-(1-methylimidazol-2-yl)sulfanylethylamino]pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 50953093 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[2-[2-(1-methylimidazol-2-yl)sulfanylethylamino]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | Cn1ccnc1SCCNc1nccc(N2CCC(O)CC2)n1 |
| InChI | InChI=1S/C15H22N6OS/c1-20-10-6-18-15(20)23-11-7-17-14-16-5-2-13(19-14)21-8-3-12(22)4-9-21/h2,5-6,10,12,22H,3-4,7-9,11H2,1H3,(H,16,17,19) |
| InChIKey | VRVXDPSSMWUXQN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|