C16H20ClN5 — CID 50954973
3-chloro-6-[4-[(5-ethyl-2-pyridinyl)methyl]piperazin-1-yl]pyridazine (PubChem CID 50954973) has the molecular formula C16H20ClN5 and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-chloro-6-[4-[(5-ethyl-2-pyridinyl)methyl]piperazin-1-yl]pyridazine.
| Compound Name | 3-chloro-6-[4-[(5-ethyl-2-pyridinyl)methyl]piperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 50954973 |
| Molecular Formula | C16H20ClN5 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-chloro-6-[4-[(5-ethyl-2-pyridinyl)methyl]piperazin-1-yl]pyridazine |
| SMILES | CCc1ccc(CN2CCN(c3ccc(Cl)nn3)CC2)nc1 |
| InChI | InChI=1S/C16H20ClN5/c1-2-13-3-4-14(18-11-13)12-21-7-9-22(10-8-21)16-6-5-15(17)19-20-16/h3-6,11H,2,7-10,12H2,1H3 |
| InChIKey | YGRQJTJHEYNFSO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |