C14H22FN5O3S — CID 50957459
5-fluoro-N-[(4-methylsulfonylmorpholin-2-yl)methyl]-4-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 50957459) has the molecular formula C14H22FN5O3S and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-fluoro-N-[(4-methylsulfonylmorpholin-2-yl)methyl]-4-pyrrolidin-1-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(4-methylsulfonylmorpholin-2-yl)methyl]-4-pyrrolidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 50957459 |
| Molecular Formula | C14H22FN5O3S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-fluoro-N-[(4-methylsulfonylmorpholin-2-yl)methyl]-4-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCOC(CNc2ncc(F)c(N3CCCC3)n2)C1 |
| InChI | InChI=1S/C14H22FN5O3S/c1-24(21,22)20-6-7-23-11(10-20)8-16-14-17-9-12(15)13(18-14)19-4-2-3-5-19/h9,11H,2-8,10H2,1H3,(H,16,17,18) |
| InChIKey | BDDKGMKLGQUHSQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |