C19H28ClN3O2 — CID 50957798
N-(3-chloro-4-methylphenyl)-N'-methyl-N'-[(1-propan-2-ylpyrrolidin-3-yl)methyl]propanediamide (PubChem CID 50957798) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-methyl-N'-[(1-propan-2-ylpyrrolidin-3-yl)methyl]propanediamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-methyl-N'-[(1-propan-2-ylpyrrolidin-3-yl)methyl]propanediamide |
|---|---|
| PubChem CID | 50957798 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-methyl-N'-[(1-propan-2-ylpyrrolidin-3-yl)methyl]propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N(C)CC2CCN(C(C)C)C2)cc1Cl |
| InChI | InChI=1S/C19H28ClN3O2/c1-13(2)23-8-7-15(12-23)11-22(4)19(25)10-18(24)21-16-6-5-14(3)17(20)9-16/h5-6,9,13,15H,7-8,10-12H2,1-4H3,(H,21,24) |
| InChIKey | YXKSCYZZHNSOFY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|