C17H26ClN3O — CID 16842233
1-(3-chloro-4-methylphenyl)-3-[2-(4-methylpiperidin-1-yl)propyl]urea (PubChem CID 16842233) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-(4-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-(4-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 16842233 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-(4-methylpiperidin-1-yl)propyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC(C)N2CCC(C)CC2)cc1Cl |
| InChI | InChI=1S/C17H26ClN3O/c1-12-6-8-21(9-7-12)14(3)11-19-17(22)20-15-5-4-13(2)16(18)10-15/h4-5,10,12,14H,6-9,11H2,1-3H3,(H2,19,20,22) |
| InChIKey | RBDHCRKIHPBSHU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |