C18H28N4O3 — CID 95154757
methyl N-[4-[[(2R)-2-(4-methylpiperidin-1-yl)propyl]carbamoylamino]phenyl]carbamate (PubChem CID 95154757) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is methyl N-[4-[[(2R)-2-(4-methylpiperidin-1-yl)propyl]carbamoylamino]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(2R)-2-(4-methylpiperidin-1-yl)propyl]carbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 95154757 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | methyl N-[4-[[(2R)-2-(4-methylpiperidin-1-yl)propyl]carbamoylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)NC[C@@H](C)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O3/c1-13-8-10-22(11-9-13)14(2)12-19-17(23)20-15-4-6-16(7-5-15)21-18(24)25-3/h4-7,13-14H,8-12H2,1-3H3,(H,21,24)(H2,19,20,23)/t14-/m1/s1 |
| InChIKey | HXNODKKWTMUAGT-CQSZACIVSA-N |
| XLogP | 3.11 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |