C20H29N7O — CID 51127008
1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-(4-methylpiperidin-1-yl)propyl]urea (PubChem CID 51127008) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-(4-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-(4-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51127008 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-(4-methylpiperidin-1-yl)propyl]urea |
| SMILES | CC1CCN(C(C)CNC(=O)Nc2cccc(-c3nnnn3C3CC3)c2)CC1 |
| InChI | InChI=1S/C20H29N7O/c1-14-8-10-26(11-9-14)15(2)13-21-20(28)22-17-5-3-4-16(12-17)19-23-24-25-27(19)18-6-7-18/h3-5,12,14-15,18H,6-11,13H2,1-2H3,(H2,21,22,28) |
| InChIKey | YFJLBGMKVMAVCL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |