C16H20N4O5 — CID 50958554
N-[3-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]propanamide (PubChem CID 50958554) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[3-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]propanamide.
| Compound Name | N-[3-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 50958554 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[3-[2-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethylamino]-2-oxoethoxy]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(OCC(=O)NCCOc2nonc2C)c1 |
| InChI | InChI=1S/C16H20N4O5/c1-3-14(21)18-12-5-4-6-13(9-12)24-10-15(22)17-7-8-23-16-11(2)19-25-20-16/h4-6,9H,3,7-8,10H2,1-2H3,(H,17,22)(H,18,21) |
| InChIKey | IMVXRQFPPXWJSO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|