C19H23N3OS — CID 50959236
2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-(3-phenylprop-2-ynyl)-N-prop-2-enylacetamide (PubChem CID 50959236) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-(3-phenylprop-2-ynyl)-N-prop-2-enylacetamide.
| Compound Name | 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-(3-phenylprop-2-ynyl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 50959236 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-(3-phenylprop-2-ynyl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC#Cc1ccccc1)C(=O)C[C@@H]1C[C@@H](C)NC(=S)N1 |
| InChI | InChI=1S/C19H23N3OS/c1-3-11-22(12-7-10-16-8-5-4-6-9-16)18(23)14-17-13-15(2)20-19(24)21-17/h3-6,8-9,15,17H,1,11-14H2,2H3,(H2,20,21,24)/t15-,17+/m1/s1 |
| InChIKey | JYGOBWYFWPICDW-WBVHZDCISA-N |
| XLogP | 2.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|