C16H22N4O2S — CID 50960014
3-acetamido-N-(5-methyl-2-pentan-3-ylpyrazol-3-yl)thiophene-2-carboxamide (PubChem CID 50960014) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 3-acetamido-N-(5-methyl-2-pentan-3-ylpyrazol-3-yl)thiophene-2-carboxamide.
| Compound Name | 3-acetamido-N-(5-methyl-2-pentan-3-ylpyrazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 50960014 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-acetamido-N-(5-methyl-2-pentan-3-ylpyrazol-3-yl)thiophene-2-carboxamide |
| SMILES | CCC(CC)n1nc(C)cc1NC(=O)c1sccc1NC(C)=O |
| InChI | InChI=1S/C16H22N4O2S/c1-5-12(6-2)20-14(9-10(3)19-20)18-16(22)15-13(7-8-23-15)17-11(4)21/h7-9,12H,5-6H2,1-4H3,(H,17,21)(H,18,22) |
| InChIKey | SZFBYNKEJPRLAK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |