C15H22N4OS — CID 115674351
N-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]thiophen-3-yl]acetamide (PubChem CID 115674351) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is N-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 115674351 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNCCCn1nc(C)cc1C |
| InChI | InChI=1S/C15H22N4OS/c1-11-9-12(2)19(18-11)7-4-6-16-10-15-14(5-8-21-15)17-13(3)20/h5,8-9,16H,4,6-7,10H2,1-3H3,(H,17,20) |
| InChIKey | ZEARQYYQJATKKG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|