C18H27FN2O2S — CID 50960740
3-[(4-fluorophenyl)methylsulfanyl]-N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]propanamide (PubChem CID 50960740) has the molecular formula C18H27FN2O2S and a molecular weight of 354.49 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylsulfanyl]-N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]propanamide.
| Compound Name | 3-[(4-fluorophenyl)methylsulfanyl]-N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 50960740 |
| Molecular Formula | C18H27FN2O2S |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[(4-fluorophenyl)methylsulfanyl]-N-[2-[4-(hydroxymethyl)piperidin-1-yl]ethyl]propanamide |
| SMILES | O=C(CCSCc1ccc(F)cc1)NCCN1CCC(CO)CC1 |
| InChI | InChI=1S/C18H27FN2O2S/c19-17-3-1-16(2-4-17)14-24-12-7-18(23)20-8-11-21-9-5-15(13-22)6-10-21/h1-4,15,22H,5-14H2,(H,20,23) |
| InChIKey | MJEQUTPSITWBJO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|