C18H27FN2O3S — CID 3238643
3-[(2-fluorophenyl)methylsulfonyl]-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 3238643) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methylsulfonyl]-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-[(2-fluorophenyl)methylsulfonyl]-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 3238643 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-[(2-fluorophenyl)methylsulfonyl]-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1F)NCCCN1CCCCC1 |
| InChI | InChI=1S/C18H27FN2O3S/c19-17-8-3-2-7-16(17)15-25(23,24)14-9-18(22)20-10-6-13-21-11-4-1-5-12-21/h2-3,7-8H,1,4-6,9-15H2,(H,20,22) |
| InChIKey | HBWPJQXYYGDZSX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|