C17H27N3O2 — CID 50963110
N'-[1-(dimethylamino)propan-2-yl]-N-(3-ethylphenyl)butanediamide (PubChem CID 50963110) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N'-[1-(dimethylamino)propan-2-yl]-N-(3-ethylphenyl)butanediamide.
| Compound Name | N'-[1-(dimethylamino)propan-2-yl]-N-(3-ethylphenyl)butanediamide |
|---|---|
| PubChem CID | 50963110 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N'-[1-(dimethylamino)propan-2-yl]-N-(3-ethylphenyl)butanediamide |
| SMILES | CCc1cccc(NC(=O)CCC(=O)NC(C)CN(C)C)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-5-14-7-6-8-15(11-14)19-17(22)10-9-16(21)18-13(2)12-20(3)4/h6-8,11,13H,5,9-10,12H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | GEOKNDRAVAYEQV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |