C17H26N2O3 — CID 50971913
N'-(3-ethylphenyl)-N-(3-hydroxy-2,2-dimethylpropyl)butanediamide (PubChem CID 50971913) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N'-(3-ethylphenyl)-N-(3-hydroxy-2,2-dimethylpropyl)butanediamide.
| Compound Name | N'-(3-ethylphenyl)-N-(3-hydroxy-2,2-dimethylpropyl)butanediamide |
|---|---|
| PubChem CID | 50971913 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N'-(3-ethylphenyl)-N-(3-hydroxy-2,2-dimethylpropyl)butanediamide |
| SMILES | CCc1cccc(NC(=O)CCC(=O)NCC(C)(C)CO)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-13-6-5-7-14(10-13)19-16(22)9-8-15(21)18-11-17(2,3)12-20/h5-7,10,20H,4,8-9,11-12H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | FXOZJRAESXLMGN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |