C36H38O6 — CID 5096400
(17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl) 9,10-dioxoanthracene-2-carboxylate (PubChem CID 5096400) has the molecular formula C36H38O6 and a molecular weight of 566.69 g/mol. Its IUPAC name is (17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl) 9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl) 9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 5096400 |
| Molecular Formula | C36H38O6 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | (17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl) 9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3CC(OC(=O)c3ccc4c(c3)C(=O)c3ccccc3C4=O)C12C |
| InChI | InChI=1S/C36H38O6/c1-19(37)28-12-13-29-26-11-9-21-17-22(38)14-15-35(21,2)30(26)18-31(36(28,29)3)42-34(41)20-8-10-25-27(16-20)33(40)24-7-5-4-6-23(24)32(25)39/h4-8,10,16,21,26,28-31H,9,11-15,17-18H2,1-3H3 |
| InChIKey | ONMZIPMOVQAMQO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|