C16H20N4O5 — CID 50964274
4-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]morpholine-3,5-dione (PubChem CID 50964274) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]morpholine-3,5-dione.
| Compound Name | 4-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 50964274 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[2-(2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)-2-oxoethyl]morpholine-3,5-dione |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)CN1C(=O)COCC1=O)CC2 |
| InChI | InChI=1S/C16H20N4O5/c1-10-17-12-4-6-19(5-3-11(12)16(24)18(10)2)13(21)7-20-14(22)8-25-9-15(20)23/h3-9H2,1-2H3 |
| InChIKey | SZEJPGAQXOYZPP-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|