C16H25N3O3 — CID 50970738
7-(2-butoxyacetyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one (PubChem CID 50970738) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 7-(2-butoxyacetyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-(2-butoxyacetyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 50970738 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 7-(2-butoxyacetyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
| SMILES | CCCCOCC(=O)N1CCc2nc(C)n(C)c(=O)c2CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-4-5-10-22-11-15(20)19-8-6-13-14(7-9-19)17-12(2)18(3)16(13)21/h4-11H2,1-3H3 |
| InChIKey | YZXGLYJENSKCCG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|