C20H19N5O — CID 50966393
3-[3-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-5-phenylimidazol-4-yl]pyridine (PubChem CID 50966393) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-[3-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-5-phenylimidazol-4-yl]pyridine.
| Compound Name | 3-[3-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-5-phenylimidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 50966393 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[3-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-5-phenylimidazol-4-yl]pyridine |
| SMILES | COCc1cc(Cn2cnc(-c3ccccc3)c2-c2cccnc2)[nH]n1 |
| InChI | InChI=1S/C20H19N5O/c1-26-13-18-10-17(23-24-18)12-25-14-22-19(15-6-3-2-4-7-15)20(25)16-8-5-9-21-11-16/h2-11,14H,12-13H2,1H3,(H,23,24) |
| InChIKey | OGGYFQCBYYYGNN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |