C20H33N3O2 — CID 50967194
4-[(dipropylamino)methyl]-N-methyl-N-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 50967194) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 4-[(dipropylamino)methyl]-N-methyl-N-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-[(dipropylamino)methyl]-N-methyl-N-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 50967194 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 4-[(dipropylamino)methyl]-N-methyl-N-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | CCCN(CCC)Cc1ccc(C(=O)N(C)C(C)(C)C(=O)NC)cc1 |
| InChI | InChI=1S/C20H33N3O2/c1-7-13-23(14-8-2)15-16-9-11-17(12-10-16)18(24)22(6)20(3,4)19(25)21-5/h9-12H,7-8,13-15H2,1-6H3,(H,21,25) |
| InChIKey | ZHKNCMXFFLCQTI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |