C17H14F2N2 — CID 50967402
5-(2,6-difluoro-3-methylphenyl)-1-methyl-4-phenylimidazole (PubChem CID 50967402) has the molecular formula C17H14F2N2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 5-(2,6-difluoro-3-methylphenyl)-1-methyl-4-phenylimidazole.
| Compound Name | 5-(2,6-difluoro-3-methylphenyl)-1-methyl-4-phenylimidazole |
|---|---|
| PubChem CID | 50967402 |
| Molecular Formula | C17H14F2N2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-(2,6-difluoro-3-methylphenyl)-1-methyl-4-phenylimidazole |
| SMILES | Cc1ccc(F)c(-c2c(-c3ccccc3)ncn2C)c1F |
| InChI | InChI=1S/C17H14F2N2/c1-11-8-9-13(18)14(15(11)19)17-16(20-10-21(17)2)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | UBRNUHGZUDAQFG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |