C15H11N5S2 — CID 10471568
2-(3-methyl-5-phenylimidazol-4-yl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (PubChem CID 10471568) has the molecular formula C15H11N5S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-(3-methyl-5-phenylimidazol-4-yl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
| Compound Name | 2-(3-methyl-5-phenylimidazol-4-yl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
|---|---|
| PubChem CID | 10471568 |
| Molecular Formula | C15H11N5S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(3-methyl-5-phenylimidazol-4-yl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| SMILES | Cn1cnc(-c2ccccc2)c1-c1nc2c(=S)[nH]cnc2s1 |
| InChI | InChI=1S/C15H11N5S2/c1-20-8-18-10(9-5-3-2-4-6-9)12(20)15-19-11-13(21)16-7-17-14(11)22-15/h2-8H,1H3,(H,16,17,21) |
| InChIKey | MTFWNXHVJMGEFT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|