C18H12N2S2 — CID 39146845
5-(4-phenylphenyl)-3H-thieno[2,3-d]pyrimidine-4-thione (PubChem CID 39146845) has the molecular formula C18H12N2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-3H-thieno[2,3-d]pyrimidine-4-thione.
| Compound Name | 5-(4-phenylphenyl)-3H-thieno[2,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 39146845 |
| Molecular Formula | C18H12N2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 5-(4-phenylphenyl)-3H-thieno[2,3-d]pyrimidine-4-thione |
| SMILES | S=c1[nH]cnc2scc(-c3ccc(-c4ccccc4)cc3)c12 |
| InChI | InChI=1S/C18H12N2S2/c21-17-16-15(10-22-18(16)20-11-19-17)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H,19,20,21) |
| InChIKey | VLLYZZQOILUXAR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|