C12H9BN2O3S — CID 167730220
[4-(4-oxo-3H-thieno[2,3-d]pyrimidin-5-yl)phenyl]boronic acid (PubChem CID 167730220) has the molecular formula C12H9BN2O3S and a molecular weight of 272.09 g/mol. Its IUPAC name is [4-(4-oxo-3H-thieno[2,3-d]pyrimidin-5-yl)phenyl]boronic acid.
| Compound Name | [4-(4-oxo-3H-thieno[2,3-d]pyrimidin-5-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 167730220 |
| Molecular Formula | C12H9BN2O3S |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | [4-(4-oxo-3H-thieno[2,3-d]pyrimidin-5-yl)phenyl]boronic acid |
| SMILES | O=c1[nH]cnc2scc(-c3ccc(B(O)O)cc3)c12 |
| InChI | InChI=1S/C12H9BN2O3S/c16-11-10-9(5-19-12(10)15-6-14-11)7-1-3-8(4-2-7)13(17)18/h1-6,17-18H,(H,14,15,16) |
| InChIKey | RBVYOILRWDVNBD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|