C12H9N3OS — CID 67382174
5-(5-methyl-2-pyridinyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 67382174) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-(5-methyl-2-pyridinyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(5-methyl-2-pyridinyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 67382174 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-(5-methyl-2-pyridinyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2csc3nc[nH]c(=O)c23)nc1 |
| InChI | InChI=1S/C12H9N3OS/c1-7-2-3-9(13-4-7)8-5-17-12-10(8)11(16)14-6-15-12/h2-6H,1H3,(H,14,15,16) |
| InChIKey | GEGMIUCXUSYEAT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |