C12H8N2S — CID 102204440
7-phenylthieno[2,3-b]pyrazine (PubChem CID 102204440) has the molecular formula C12H8N2S and a molecular weight of 212.28 g/mol. Its IUPAC name is 7-phenylthieno[2,3-b]pyrazine.
| Compound Name | 7-phenylthieno[2,3-b]pyrazine |
|---|---|
| PubChem CID | 102204440 |
| Molecular Formula | C12H8N2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 7-phenylthieno[2,3-b]pyrazine |
| SMILES | c1ccc(-c2csc3nccnc23)cc1 |
| InChI | InChI=1S/C12H8N2S/c1-2-4-9(5-3-1)10-8-15-12-11(10)13-6-7-14-12/h1-8H |
| InChIKey | BXRNCKNXKCGIIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |