C13H9NOS — CID 139624317
4-thieno[2,3-b]pyridin-3-ylphenol (PubChem CID 139624317) has the molecular formula C13H9NOS and a molecular weight of 227.29 g/mol. Its IUPAC name is 4-thieno[2,3-b]pyridin-3-ylphenol.
| Compound Name | 4-thieno[2,3-b]pyridin-3-ylphenol |
|---|---|
| PubChem CID | 139624317 |
| Molecular Formula | C13H9NOS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-thieno[2,3-b]pyridin-3-ylphenol |
| SMILES | Oc1ccc(-c2csc3ncccc23)cc1 |
| InChI | InChI=1S/C13H9NOS/c15-10-5-3-9(4-6-10)12-8-16-13-11(12)2-1-7-14-13/h1-8,15H |
| InChIKey | DLVFQQWRKFEIAF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |