C12H12N2S — CID 139629965
3-thieno[2,3-b]pyridin-3-ylcyclopent-2-en-1-amine (PubChem CID 139629965) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-thieno[2,3-b]pyridin-3-ylcyclopent-2-en-1-amine.
| Compound Name | 3-thieno[2,3-b]pyridin-3-ylcyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 139629965 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-thieno[2,3-b]pyridin-3-ylcyclopent-2-en-1-amine |
| SMILES | NC1C=C(c2csc3ncccc23)CC1 |
| InChI | InChI=1S/C12H12N2S/c13-9-4-3-8(6-9)11-7-15-12-10(11)2-1-5-14-12/h1-2,5-7,9H,3-4,13H2 |
| InChIKey | OIKIWAHVQKTVDM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |