C10H9NS — CID 119087285
3-cyclopropylthieno[2,3-b]pyridine (PubChem CID 119087285) has the molecular formula C10H9NS and a molecular weight of 175.26 g/mol. Its IUPAC name is 3-cyclopropylthieno[2,3-b]pyridine.
| Compound Name | 3-cyclopropylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 119087285 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 3-cyclopropylthieno[2,3-b]pyridine |
| SMILES | c1cnc2scc(C3CC3)c2c1 |
| InChI | InChI=1S/C10H9NS/c1-2-8-9(7-3-4-7)6-12-10(8)11-5-1/h1-2,5-7H,3-4H2 |
| InChIKey | WCATWJUNXILRLT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |