C9H8N2OS — CID 130883012
N-(1-thieno[2,3-b]pyridin-3-ylethylidene)hydroxylamine (PubChem CID 130883012) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is N-(1-thieno[2,3-b]pyridin-3-ylethylidene)hydroxylamine.
| Compound Name | N-(1-thieno[2,3-b]pyridin-3-ylethylidene)hydroxylamine |
|---|---|
| PubChem CID | 130883012 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | N-(1-thieno[2,3-b]pyridin-3-ylethylidene)hydroxylamine |
| SMILES | CC(=NO)c1csc2ncccc12 |
| InChI | InChI=1S/C9H8N2OS/c1-6(11-12)8-5-13-9-7(8)3-2-4-10-9/h2-5,12H,1H3 |
| InChIKey | GEVLRZWMNBPZLQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|