C10H10N2OS — CID 72746402
N-[1-(3-methyl-1,2-benzothiazol-7-yl)ethylidene]hydroxylamine (PubChem CID 72746402) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is N-[1-(3-methyl-1,2-benzothiazol-7-yl)ethylidene]hydroxylamine.
| Compound Name | N-[1-(3-methyl-1,2-benzothiazol-7-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 72746402 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N-[1-(3-methyl-1,2-benzothiazol-7-yl)ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1cccc2c(C)nsc12 |
| InChI | InChI=1S/C10H10N2OS/c1-6(11-13)8-4-3-5-9-7(2)12-14-10(8)9/h3-5,13H,1-2H3 |
| InChIKey | WYTJIJZIRYWBHE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|