C12H10N4OS — CID 139629986
2-azido-4-thieno[2,3-b]pyridin-3-ylcyclopent-3-en-1-ol (PubChem CID 139629986) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-azido-4-thieno[2,3-b]pyridin-3-ylcyclopent-3-en-1-ol.
| Compound Name | 2-azido-4-thieno[2,3-b]pyridin-3-ylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 139629986 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-azido-4-thieno[2,3-b]pyridin-3-ylcyclopent-3-en-1-ol |
| SMILES | [N-]=[N+]=NC1C=C(c2csc3ncccc23)CC1O |
| InChI | InChI=1S/C12H10N4OS/c13-16-15-10-4-7(5-11(10)17)9-6-18-12-8(9)2-1-3-14-12/h1-4,6,10-11,17H,5H2 |
| InChIKey | WHEWQXMZYRTDAZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|