C15H26N6 — CID 50967713
2-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-N-propan-2-ylpyrimidin-4-amine (PubChem CID 50967713) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-N-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-N-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 50967713 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-N-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)Nc1ccnc(N2CCN3CCN(C)CC3C2)n1 |
| InChI | InChI=1S/C15H26N6/c1-12(2)17-14-4-5-16-15(18-14)21-9-8-20-7-6-19(3)10-13(20)11-21/h4-5,12-13H,6-11H2,1-3H3,(H,16,17,18) |
| InChIKey | RIRWBIFAHFEJKP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |