C11H16N6O6 — CID 5096785
3-[5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-1-methyl-1-nitrosourea (PubChem CID 5096785) has the molecular formula C11H16N6O6 and a molecular weight of 328.29 g/mol. Its IUPAC name is 3-[5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-1-methyl-1-nitrosourea.
| Compound Name | 3-[5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-1-methyl-1-nitrosourea |
|---|---|
| PubChem CID | 5096785 |
| Molecular Formula | C11H16N6O6 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-[5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-1-methyl-1-nitrosourea |
| SMILES | CN(N=O)C(=O)NC1C(CO)OC(n2ccc(N)nc2=O)C1O |
| InChI | InChI=1S/C11H16N6O6/c1-16(15-22)10(20)14-7-5(4-18)23-9(8(7)19)17-3-2-6(12)13-11(17)21/h2-3,5,7-9,18-19H,4H2,1H3,(H,14,20)(H2,12,13,21) |
| InChIKey | OLIFMEWUOOHLGX-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 172.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|