C19H24N2O2 — CID 50968651
3,5-dimethyl-2-[[[2-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]-1H-pyridin-4-one (PubChem CID 50968651) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3,5-dimethyl-2-[[[2-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]-1H-pyridin-4-one.
| Compound Name | 3,5-dimethyl-2-[[[2-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 50968651 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3,5-dimethyl-2-[[[2-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]-1H-pyridin-4-one |
| SMILES | C=C(C)COc1ccccc1CNCc1[nH]cc(C)c(=O)c1C |
| InChI | InChI=1S/C19H24N2O2/c1-13(2)12-23-18-8-6-5-7-16(18)10-20-11-17-15(4)19(22)14(3)9-21-17/h5-9,20H,1,10-12H2,2-4H3,(H,21,22) |
| InChIKey | BMHCBNMMBQTQCE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|