C17H31N3O — CID 50969617
1-[4-[[1-(3-methylbutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 50969617) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-[4-[[1-(3-methylbutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[1-(3-methylbutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 50969617 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1-[4-[[1-(3-methylbutyl)-3,6-dihydro-2H-pyridin-5-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC2=CCCN(CCC(C)C)C2)CC1 |
| InChI | InChI=1S/C17H31N3O/c1-15(2)6-8-18-7-4-5-17(13-18)14-19-9-11-20(12-10-19)16(3)21/h5,15H,4,6-14H2,1-3H3 |
| InChIKey | KMGJDWDPOKDPGB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|