C18H27N3O3 — CID 50969708
7-(2,2-dimethyloxane-4-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one (PubChem CID 50969708) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 7-(2,2-dimethyloxane-4-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-(2,2-dimethyloxane-4-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 50969708 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 7-(2,2-dimethyloxane-4-carbonyl)-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)C1CCOC(C)(C)C1)CC2 |
| InChI | InChI=1S/C18H27N3O3/c1-12-19-15-6-9-21(8-5-14(15)17(23)20(12)4)16(22)13-7-10-24-18(2,3)11-13/h13H,5-11H2,1-4H3 |
| InChIKey | FJUPCZCUZZRGCA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |