C15H21N3O4S — CID 125158035
7-[(3R)-1,1-dioxothiolane-3-carbonyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one (PubChem CID 125158035) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 7-[(3R)-1,1-dioxothiolane-3-carbonyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[(3R)-1,1-dioxothiolane-3-carbonyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 125158035 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 7-[(3R)-1,1-dioxothiolane-3-carbonyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)[C@H]1CCS(=O)(=O)C1)CC2 |
| InChI | InChI=1S/C15H21N3O4S/c1-10-16-13-4-7-18(6-3-12(13)15(20)17(10)2)14(19)11-5-8-23(21,22)9-11/h11H,3-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | QUXWUALTSIVXOJ-NSHDSACASA-N |
| XLogP | -0.55 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |