C22H22N4O2 — CID 50972954
3-[3-[3-(2-hydroxyethyl)-5-phenylimidazol-4-yl]indol-1-yl]propanamide (PubChem CID 50972954) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[3-[3-(2-hydroxyethyl)-5-phenylimidazol-4-yl]indol-1-yl]propanamide.
| Compound Name | 3-[3-[3-(2-hydroxyethyl)-5-phenylimidazol-4-yl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 50972954 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[3-[3-(2-hydroxyethyl)-5-phenylimidazol-4-yl]indol-1-yl]propanamide |
| SMILES | NC(=O)CCn1cc(-c2c(-c3ccccc3)ncn2CCO)c2ccccc21 |
| InChI | InChI=1S/C22H22N4O2/c23-20(28)10-11-25-14-18(17-8-4-5-9-19(17)25)22-21(16-6-2-1-3-7-16)24-15-26(22)12-13-27/h1-9,14-15,27H,10-13H2,(H2,23,28) |
| InChIKey | MNXJFFLTRUVIKT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |