C14H18N6S2 — CID 50973073
5-ethyl-6-methyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 50973073) has the molecular formula C14H18N6S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 5-ethyl-6-methyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-ethyl-6-methyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 50973073 |
| Molecular Formula | C14H18N6S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-ethyl-6-methyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1c(C)sc2ncnc(NCCSc3nncn3C)c12 |
| InChI | InChI=1S/C14H18N6S2/c1-4-10-9(2)22-13-11(10)12(16-7-17-13)15-5-6-21-14-19-18-8-20(14)3/h7-8H,4-6H2,1-3H3,(H,15,16,17) |
| InChIKey | KSGJECUKWWHVAX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|