C20H25N5O2 — CID 50974809
(3aR,6aR)-5-(cyclopropanecarbonyl)-N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50974809) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3aR,6aR)-5-(cyclopropanecarbonyl)-N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-5-(cyclopropanecarbonyl)-N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50974809 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3aR,6aR)-5-(cyclopropanecarbonyl)-N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1cccn2c(CNC(=O)[C@@]34CNC[C@@H]3CN(C(=O)C3CC3)C4)cnc12 |
| InChI | InChI=1S/C20H25N5O2/c1-13-3-2-6-25-16(8-22-17(13)25)9-23-19(27)20-11-21-7-15(20)10-24(12-20)18(26)14-4-5-14/h2-3,6,8,14-15,21H,4-5,7,9-12H2,1H3,(H,23,27)/t15-,20-/m1/s1 |
| InChIKey | QLPIMNHDXZNABT-FOIQADDNSA-N |
| XLogP | 0.72 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |