C17H24N4O3 — CID 133120548
(3aS,6aS)-5-acetyl-N-(3-pyridin-3-yloxypropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 133120548) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3aS,6aS)-5-acetyl-N-(3-pyridin-3-yloxypropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aS)-5-acetyl-N-(3-pyridin-3-yloxypropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 133120548 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (3aS,6aS)-5-acetyl-N-(3-pyridin-3-yloxypropyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CC(=O)N1C[C@@H]2CNC[C@]2(C(=O)NCCCOc2cccnc2)C1 |
| InChI | InChI=1S/C17H24N4O3/c1-13(22)21-10-14-8-19-11-17(14,12-21)16(23)20-6-3-7-24-15-4-2-5-18-9-15/h2,4-5,9,14,19H,3,6-8,10-12H2,1H3,(H,20,23)/t14-,17-/m0/s1 |
| InChIKey | IUQUEKGOLGAKPA-YOEHRIQHSA-N |
| XLogP | 0.03 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|