C12H15N5O3 — CID 156584225
1-methyl-5-oxo-N-(3-pyridin-3-yloxypropyl)-4H-1,2,4-triazole-3-carboxamide (PubChem CID 156584225) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-methyl-5-oxo-N-(3-pyridin-3-yloxypropyl)-4H-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-methyl-5-oxo-N-(3-pyridin-3-yloxypropyl)-4H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 156584225 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-methyl-5-oxo-N-(3-pyridin-3-yloxypropyl)-4H-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCCOc2cccnc2)[nH]c1=O |
| InChI | InChI=1S/C12H15N5O3/c1-17-12(19)15-10(16-17)11(18)14-6-3-7-20-9-4-2-5-13-8-9/h2,4-5,8H,3,6-7H2,1H3,(H,14,18)(H,15,16,19) |
| InChIKey | LUDDAVALLYKMMM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|