C18H18N4O2 — CID 70748016
3-pyrazol-1-yl-N-(3-pyridin-3-yloxypropyl)benzamide (PubChem CID 70748016) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-(3-pyridin-3-yloxypropyl)benzamide.
| Compound Name | 3-pyrazol-1-yl-N-(3-pyridin-3-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 70748016 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-pyrazol-1-yl-N-(3-pyridin-3-yloxypropyl)benzamide |
| SMILES | O=C(NCCCOc1cccnc1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H18N4O2/c23-18(20-9-4-12-24-17-7-2-8-19-14-17)15-5-1-6-16(13-15)22-11-3-10-21-22/h1-3,5-8,10-11,13-14H,4,9,12H2,(H,20,23) |
| InChIKey | YYTKRARMRYLZMB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|