C19H28N4O — CID 50976959
3-(1,3-dihydroisoindol-2-yl)-1-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propan-1-one (PubChem CID 50976959) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)-1-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propan-1-one.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)-1-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propan-1-one |
|---|---|
| PubChem CID | 50976959 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)-1-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)propan-1-one |
| SMILES | CN1CCN2CCN(C(=O)CCN3Cc4ccccc4C3)CC2C1 |
| InChI | InChI=1S/C19H28N4O/c1-20-8-9-22-10-11-23(15-18(22)14-20)19(24)6-7-21-12-16-4-2-3-5-17(16)13-21/h2-5,18H,6-15H2,1H3 |
| InChIKey | GRDZGMOMOGATLL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |