C23H19N5 — CID 50977151
3-[3-[2-(1H-imidazol-5-yl)ethyl]-5-phenylimidazol-4-yl]quinoline (PubChem CID 50977151) has the molecular formula C23H19N5 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-[3-[2-(1H-imidazol-5-yl)ethyl]-5-phenylimidazol-4-yl]quinoline.
| Compound Name | 3-[3-[2-(1H-imidazol-5-yl)ethyl]-5-phenylimidazol-4-yl]quinoline |
|---|---|
| PubChem CID | 50977151 |
| Molecular Formula | C23H19N5 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-[3-[2-(1H-imidazol-5-yl)ethyl]-5-phenylimidazol-4-yl]quinoline |
| SMILES | c1ccc(-c2ncn(CCc3cnc[nH]3)c2-c2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H19N5/c1-2-6-17(7-3-1)22-23(19-12-18-8-4-5-9-21(18)25-13-19)28(16-27-22)11-10-20-14-24-15-26-20/h1-9,12-16H,10-11H2,(H,24,26) |
| InChIKey | AHAHPGZWZGLZMY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |